5-Iodo-pyridine-3-carbaldehyde
Catalog No: FT-0678192
CAS No: 879326-76-8
- Chemical Name: 5-Iodo-pyridine-3-carbaldehyde
- Molecular Formula: C6H4INO
- Molecular Weight: 233.01
- InChI Key: IGCFPWASPXMWNO-UHFFFAOYSA-N
- InChI: InChI=1S/C6H4INO/c7-6-1-5(4-9)2-8-3-6/h1-4H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 233.00700 |
| Density: | 2.002g/cm3 |
| CAS: | 879326-76-8 |
| Bolling_Point: | 300.847ºC at 760 mmHg |
| Product_Name: | 5-iodopyridine-3-carbaldehyde |
| Melting_Point: | 148-149ºC |
| Flash_Point: | 135.748ºC |
| MF: | C6H4INO |
| Density: | 2.002g/cm3 |
|---|---|
| LogP: | 1.49870 |
| Flash_Point: | 135.748ºC |
| Melting_Point: | 148-149ºC |
| FW: | 233.00700 |
| PSA: | 29.96000 |
| Exact_Mass: | 232.93400 |
| MF: | C6H4INO |
| Bolling_Point: | 300.847ºC at 760 mmHg |
| Refractive_Index: | 1.68 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H336 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)